C13H22O2 — CID 134838724
(2R,5R,8R)-2,6,6,10-tetramethyl-1-oxaspiro[4.5]dec-9-en-8-ol (PubChem CID 134838724) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (2R,5R,8R)-2,6,6,10-tetramethyl-1-oxaspiro[4.5]dec-9-en-8-ol.
| Compound Name | (2R,5R,8R)-2,6,6,10-tetramethyl-1-oxaspiro[4.5]dec-9-en-8-ol |
|---|---|
| PubChem CID | 134838724 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (2R,5R,8R)-2,6,6,10-tetramethyl-1-oxaspiro[4.5]dec-9-en-8-ol |
| SMILES | CC1=C[C@H](O)CC(C)(C)[C@]12CC[C@@H](C)O2 |
| InChI | InChI=1S/C13H22O2/c1-9-7-11(14)8-12(3,4)13(9)6-5-10(2)15-13/h7,10-11,14H,5-6,8H2,1-4H3/t10-,11+,13+/m1/s1 |
| InChIKey | AVMRWEITZUAUJV-MDZLAQPJSA-N |
| XLogP | 2.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|