About (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-enal
(3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-enal (PubChem CID 134838803) has the molecular formula C14H28O2Si
and a molecular weight of 256.46 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-enal.
Molecular Properties
| Compound Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-enal |
| PubChem CID | 134838803 |
| Molecular Formula | C14H28O2Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-enal |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C=O |
| InChI | InChI=1S/C14H28O2Si/c1-9-10-12(14(5,6)11-15)16-17(7,8)13(2,3)4/h9,11-12H,1,10H2,2-8H3/t12-/m0/s1 |
| InChIKey | FZRJSOCXCGLGFL-LBPRGKRZSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-enal?
The IUPAC name of (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-enal (CID 134838803) is (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-enal.
What is the SMILES notation for (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-enal?
The canonical SMILES for (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-enal is C=CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C=O.
What is the InChIKey of (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-enal?
The InChIKey is FZRJSOCXCGLGFL-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H28O2Si/c1-9-10-12(14(5,6)11-15)16-17(7,8)13(2,3)4/h9,11-12H,1,10H2,2-8H3/t12-/m0/s1.
What are the key properties of (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-enal?
(3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-enal has a molecular weight of 256.46 g/mol, XLogP of 4.18, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-enal is sourced from PubChem (CID 134838803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).