C19H29NO2 — CID 134838858
(E)-6-phenylmethoxy-N,N-di(propan-2-yl)hex-3-enamide (PubChem CID 134838858) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (E)-6-phenylmethoxy-N,N-di(propan-2-yl)hex-3-enamide.
| Compound Name | (E)-6-phenylmethoxy-N,N-di(propan-2-yl)hex-3-enamide |
|---|---|
| PubChem CID | 134838858 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (E)-6-phenylmethoxy-N,N-di(propan-2-yl)hex-3-enamide |
| SMILES | CC(C)N(C(=O)C/C=C/CCOCc1ccccc1)C(C)C |
| InChI | InChI=1S/C19H29NO2/c1-16(2)20(17(3)4)19(21)13-9-6-10-14-22-15-18-11-7-5-8-12-18/h5-9,11-12,16-17H,10,13-15H2,1-4H3/b9-6+ |
| InChIKey | VJRGWDRCYYZGOE-RMKNXTFCSA-N |
| XLogP | 4.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|