C16H12F2O2S — CID 134838916
[4-(benzenesulfonyl)-4,4-difluorobuta-1,2-dienyl]benzene (PubChem CID 134838916) has the molecular formula C16H12F2O2S and a molecular weight of 306.33 g/mol. Its IUPAC name is [4-(benzenesulfonyl)-4,4-difluorobuta-1,2-dienyl]benzene.
| Compound Name | [4-(benzenesulfonyl)-4,4-difluorobuta-1,2-dienyl]benzene |
|---|---|
| PubChem CID | 134838916 |
| Molecular Formula | C16H12F2O2S |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | [4-(benzenesulfonyl)-4,4-difluorobuta-1,2-dienyl]benzene |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)C=C=Cc1ccccc1 |
| InChI | InChI=1S/C16H12F2O2S/c17-16(18,13-7-10-14-8-3-1-4-9-14)21(19,20)15-11-5-2-6-12-15/h1-6,8-13H |
| InChIKey | MPZLXMFQTALDDG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |