C29H44O5Si — CID 134839048
[(1R,2R,4S,5R,6S,8R)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-11-methylidene-5-phenylmethoxy-12-oxatricyclo[6.3.1.01,6]dodecan-4-yl] acetate (PubChem CID 134839048) has the molecular formula C29H44O5Si and a molecular weight of 500.75 g/mol. Its IUPAC name is [(1R,2R,4S,5R,6S,8R)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-11-methylidene-5-phenylmethoxy-12-oxatricyclo[6.3.1.01,6]dodecan-4-yl] acetate.
| Compound Name | [(1R,2R,4S,5R,6S,8R)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-11-methylidene-5-phenylmethoxy-12-oxatricyclo[6.3.1.01,6]dodecan-4-yl] acetate |
|---|---|
| PubChem CID | 134839048 |
| Molecular Formula | C29H44O5Si |
| Molecular Weight | 500.75 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | [(1R,2R,4S,5R,6S,8R)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-11-methylidene-5-phenylmethoxy-12-oxatricyclo[6.3.1.01,6]dodecan-4-yl] acetate |
| SMILES | C=C1CC[C@]2(CO[Si](C)(C)C(C)(C)C)C[C@H]3[C@@H](OCc4ccccc4)[C@@H](OC(C)=O)C[C@@H](C)[C@]13O2 |
| InChI | InChI=1S/C29H44O5Si/c1-20-14-15-28(19-32-35(7,8)27(4,5)6)17-24-26(31-18-23-12-10-9-11-13-23)25(33-22(3)30)16-21(2)29(20,24)34-28/h9-13,21,24-26H,1,14-19H2,2-8H3/t21-,24+,25+,26-,28-,29-/m1/s1 |
| InChIKey | PNTGDQHDSSAGIK-LURZDMEYSA-N |
| XLogP | 6.43 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.75 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|