About CID 134839275
CID 134839275 (PubChem CID 134839275) has the molecular formula C12H20NO2S2-
and a molecular weight of 274.43 g/mol.
Molecular Properties
| Compound Name | CID 134839275 |
| PubChem CID | 134839275 |
| Molecular Formula | C12H20NO2S2- |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N1CCCC1[C-]1SCCS1 |
| InChI | InChI=1S/C12H20NO2S2/c1-12(2,3)15-11(14)13-6-4-5-9(13)10-16-7-8-17-10/h9H,4-8H2,1-3H3/q-1 |
| InChIKey | FLWPJPDBAUNIFO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 134839275 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134839275?
The IUPAC name of CID 134839275 (CID 134839275) is not available.
What is the SMILES notation for CID 134839275?
The canonical SMILES for CID 134839275 is CC(C)(C)OC(=O)N1CCCC1[C-]1SCCS1.
What is the InChIKey of CID 134839275?
The InChIKey is FLWPJPDBAUNIFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20NO2S2/c1-12(2,3)15-11(14)13-6-4-5-9(13)10-16-7-8-17-10/h9H,4-8H2,1-3H3/q-1.
What are the key properties of CID 134839275?
CID 134839275 has a molecular weight of 274.43 g/mol, XLogP of 3.36, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134839275 is sourced from PubChem (CID 134839275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).