C22H23NO9 — CID 134839500
2-O,2-O'-diethyl 3-O,4-O-dimethyl 11bH-[1,3]oxazino[2,3-a]isoquinoline-2,2,3,4-tetracarboxylate (PubChem CID 134839500) has the molecular formula C22H23NO9 and a molecular weight of 445.42 g/mol. Its IUPAC name is 2-O,2-O'-diethyl 3-O,4-O-dimethyl 11bH-[1,3]oxazino[2,3-a]isoquinoline-2,2,3,4-tetracarboxylate.
| Compound Name | 2-O,2-O'-diethyl 3-O,4-O-dimethyl 11bH-[1,3]oxazino[2,3-a]isoquinoline-2,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 134839500 |
| Molecular Formula | C22H23NO9 |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 2-O,2-O'-diethyl 3-O,4-O-dimethyl 11bH-[1,3]oxazino[2,3-a]isoquinoline-2,2,3,4-tetracarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)OC2c3ccccc3C=CN2C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C22H23NO9/c1-5-30-20(26)22(21(27)31-6-2)15(18(24)28-3)16(19(25)29-4)23-12-11-13-9-7-8-10-14(13)17(23)32-22/h7-12,17H,5-6H2,1-4H3 |
| InChIKey | WGLLABXRTPFVTM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|