C20H34N2O3S — CID 134839604
S-tert-butyl 3,3-bis[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]butanethioate (PubChem CID 134839604) has the molecular formula C20H34N2O3S and a molecular weight of 382.57 g/mol. Its IUPAC name is S-tert-butyl 3,3-bis[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]butanethioate.
| Compound Name | S-tert-butyl 3,3-bis[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]butanethioate |
|---|---|
| PubChem CID | 134839604 |
| Molecular Formula | C20H34N2O3S |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | S-tert-butyl 3,3-bis[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]butanethioate |
| SMILES | CC(C)[C@H]1COC(C(C)(CC(=O)SC(C)(C)C)C2=N[C@@H](C(C)C)CO2)=N1 |
| InChI | InChI=1S/C20H34N2O3S/c1-12(2)14-10-24-17(21-14)20(8,9-16(23)26-19(5,6)7)18-22-15(11-25-18)13(3)4/h12-15H,9-11H2,1-8H3/t14-,15-/m1/s1 |
| InChIKey | GHZWECCMCFFSBD-HUUCEWRRSA-N |
| XLogP | 4.35 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|