About CID 134839653
CID 134839653 (PubChem CID 134839653) has the molecular formula C57H72N12
and a molecular weight of 925.29 g/mol.
Molecular Properties
| Compound Name | CID 134839653 |
| PubChem CID | 134839653 |
| Molecular Formula | C57H72N12 |
| Molecular Weight | 925.29 g/mol |
| Exact Mass | 924.60 |
| IUPAC Name | — |
| SMILES | Cc1c(CN2[C]N(Cc3ccc(CN4[C]N(C)CC4)cc3)CC2)c(C)c(CN2[C]N(Cc3ccc(CN4[C]N(C)CC4)cc3)CC2)c(C)c1CN1[C]N(Cc2ccc(CN3[C]N(C)CC3)cc2)CC1 |
| InChI | InChI=1S/C57H72N12/c1-46-55(37-67-28-25-64(43-67)34-52-13-7-49(8-14-52)31-61-22-19-58(4)40-61)47(2)57(39-69-30-27-66(45-69)36-54-17-11-51(12-18-54)33-63-24-21-60(6)42-63)48(3)56(46)38-68-29-26-65(44-68)35-53-15-9-50(10-16-53)32-62-23-20-59(5)41-62/h7-18H,19-39H2,1-6H3 |
| InChIKey | VQFBSCICFHAZSY-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 925.29 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Analyze CID 134839653 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134839653?
The IUPAC name of CID 134839653 (CID 134839653) is not available.
What is the SMILES notation for CID 134839653?
The canonical SMILES for CID 134839653 is Cc1c(CN2[C]N(Cc3ccc(CN4[C]N(C)CC4)cc3)CC2)c(C)c(CN2[C]N(Cc3ccc(CN4[C]N(C)CC4)cc3)CC2)c(C)c1CN1[C]N(Cc2ccc(CN3[C]N(C)CC3)cc2)CC1.
What is the InChIKey of CID 134839653?
The InChIKey is VQFBSCICFHAZSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C57H72N12/c1-46-55(37-67-28-25-64(43-67)34-52-13-7-49(8-14-52)31-61-22-19-58(4)40-61)47(2)57(39-69-30-27-66(45-69)36-54-17-11-51(12-18-54)33-63-24-21-60(6)42-63)48(3)56(46)38-68-29-26-65(44-68)35-53-15-9-50(10-16-53)32-62-23-20-59(5)41-62/h7-18H,19-39H2,1-6H3.
What are the key properties of CID 134839653?
CID 134839653 has a molecular weight of 925.29 g/mol, XLogP of 5.79, 18 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134839653 is sourced from PubChem (CID 134839653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).