C23H42O5Si — CID 134839707
tert-butyl-[(2R)-2-[(4R,5R)-5-[(1S)-1-(methoxymethoxy)-2,2-dimethylbut-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-yn-2-yl]oxy-dimethylsilane (PubChem CID 134839707) has the molecular formula C23H42O5Si and a molecular weight of 426.67 g/mol. Its IUPAC name is tert-butyl-[(2R)-2-[(4R,5R)-5-[(1S)-1-(methoxymethoxy)-2,2-dimethylbut-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-yn-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R)-2-[(4R,5R)-5-[(1S)-1-(methoxymethoxy)-2,2-dimethylbut-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-yn-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134839707 |
| Molecular Formula | C23H42O5Si |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | tert-butyl-[(2R)-2-[(4R,5R)-5-[(1S)-1-(methoxymethoxy)-2,2-dimethylbut-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-yn-2-yl]oxy-dimethylsilane |
| SMILES | C#C[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@@H]1[C@@H](OCOC)C(C)(C)C=C |
| InChI | InChI=1S/C23H42O5Si/c1-14-21(6,7)18(25-16-24-11)17-19(27-22(8,9)26-17)23(10,15-2)28-29(12,13)20(3,4)5/h2,14,17-19H,1,16H2,3-13H3/t17-,18-,19-,23-/m1/s1 |
| InChIKey | FAZOZXGREHOYGG-FZONSQQESA-N |
| XLogP | 5.12 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|