C21H28N2O2 — CID 134839866
(4R)-2-[(1S,2S)-2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]cyclopentyl]-4-phenyl-4,5-dihydro-1,3-oxazole (PubChem CID 134839866) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is (4R)-2-[(1S,2S)-2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]cyclopentyl]-4-phenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R)-2-[(1S,2S)-2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]cyclopentyl]-4-phenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 134839866 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (4R)-2-[(1S,2S)-2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]cyclopentyl]-4-phenyl-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)(C)[C@H]1COC([C@H]2CCC[C@@H]2C2=N[C@H](c3ccccc3)CO2)=N1 |
| InChI | InChI=1S/C21H28N2O2/c1-21(2,3)18-13-25-20(23-18)16-11-7-10-15(16)19-22-17(12-24-19)14-8-5-4-6-9-14/h4-6,8-9,15-18H,7,10-13H2,1-3H3/t15-,16-,17-,18+/m0/s1 |
| InChIKey | BEOFPEJCEAKJAT-XLAORIBOSA-N |
| XLogP | 4.42 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |