About dilithium;N-methanidyl-N'-[2-(4-methoxyphenyl)ethyl]-N-methylcarbamimidate
dilithium;N-methanidyl-N'-[2-(4-methoxyphenyl)ethyl]-N-methylcarbamimidate (PubChem CID 134839985) has the molecular formula C12H16Li2N2O2
and a molecular weight of 234.15 g/mol. Its IUPAC name is dilithium;N-methanidyl-N'-[2-(4-methoxyphenyl)ethyl]-N-methylcarbamimidate.
Molecular Properties
| Compound Name | dilithium;N-methanidyl-N'-[2-(4-methoxyphenyl)ethyl]-N-methylcarbamimidate |
| PubChem CID | 134839985 |
| Molecular Formula | C12H16Li2N2O2 |
| Molecular Weight | 234.15 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | dilithium;N-methanidyl-N'-[2-(4-methoxyphenyl)ethyl]-N-methylcarbamimidate |
| SMILES | [CH2-]N(C)/C([O-])=N/CCc1ccc(OC)cc1.[Li+].[Li+] |
| InChI | InChI=1S/C12H17N2O2.2Li/c1-14(2)12(15)13-9-8-10-4-6-11(16-3)7-5-10;;/h4-7H,1,8-9H2,2-3H3,(H,13,15);;/q-1;2*+1/p-1 |
| InChIKey | XAWLIYFVATVTHV-UHFFFAOYSA-M |
| XLogP | -5.31 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.15 |
| LogP ≤ 5 | -5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze dilithium;N-methanidyl-N'-[2-(4-methoxyphenyl)ethyl]-N-methylcarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;N-methanidyl-N'-[2-(4-methoxyphenyl)ethyl]-N-methylcarbamimidate?
The IUPAC name of dilithium;N-methanidyl-N'-[2-(4-methoxyphenyl)ethyl]-N-methylcarbamimidate (CID 134839985) is dilithium;N-methanidyl-N'-[2-(4-methoxyphenyl)ethyl]-N-methylcarbamimidate.
What is the SMILES notation for dilithium;N-methanidyl-N'-[2-(4-methoxyphenyl)ethyl]-N-methylcarbamimidate?
The canonical SMILES for dilithium;N-methanidyl-N'-[2-(4-methoxyphenyl)ethyl]-N-methylcarbamimidate is [CH2-]N(C)/C([O-])=N/CCc1ccc(OC)cc1.[Li+].[Li+].
What is the InChIKey of dilithium;N-methanidyl-N'-[2-(4-methoxyphenyl)ethyl]-N-methylcarbamimidate?
The InChIKey is XAWLIYFVATVTHV-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H17N2O2.2Li/c1-14(2)12(15)13-9-8-10-4-6-11(16-3)7-5-10;;/h4-7H,1,8-9H2,2-3H3,(H,13,15);;/q-1;2*+1/p-1.
What are the key properties of dilithium;N-methanidyl-N'-[2-(4-methoxyphenyl)ethyl]-N-methylcarbamimidate?
dilithium;N-methanidyl-N'-[2-(4-methoxyphenyl)ethyl]-N-methylcarbamimidate has a molecular weight of 234.15 g/mol, XLogP of -5.31, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;N-methanidyl-N'-[2-(4-methoxyphenyl)ethyl]-N-methylcarbamimidate is sourced from PubChem (CID 134839985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).