C24H36O4 — CID 134839989
(3aS,4E,8E,12S,13E,15aR)-2,12-dihydroxy-1-[(2S)-1-hydroxypropan-2-yl]-3a,5,9,13-tetramethyl-7,10,11,12,15,15a-hexahydro-6H-cyclopenta[14]annulen-3-one (PubChem CID 134839989) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is (3aS,4E,8E,12S,13E,15aR)-2,12-dihydroxy-1-[(2S)-1-hydroxypropan-2-yl]-3a,5,9,13-tetramethyl-7,10,11,12,15,15a-hexahydro-6H-cyclopenta[14]annulen-3-one.
| Compound Name | (3aS,4E,8E,12S,13E,15aR)-2,12-dihydroxy-1-[(2S)-1-hydroxypropan-2-yl]-3a,5,9,13-tetramethyl-7,10,11,12,15,15a-hexahydro-6H-cyclopenta[14]annulen-3-one |
|---|---|
| PubChem CID | 134839989 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (3aS,4E,8E,12S,13E,15aR)-2,12-dihydroxy-1-[(2S)-1-hydroxypropan-2-yl]-3a,5,9,13-tetramethyl-7,10,11,12,15,15a-hexahydro-6H-cyclopenta[14]annulen-3-one |
| SMILES | C/C1=C/C[C@@H]2C([C@H](C)CO)=C(O)C(=O)[C@@]2(C)/C=C(\C)CC/C=C(\C)CC[C@@H]1O |
| InChI | InChI=1S/C24H36O4/c1-15-7-6-8-16(2)13-24(5)19(11-10-17(3)20(26)12-9-15)21(18(4)14-25)22(27)23(24)28/h7,10,13,18-20,25-27H,6,8-9,11-12,14H2,1-5H3/b15-7+,16-13+,17-10-/t18-,19-,20+,24+/m1/s1 |
| InChIKey | STWGJWULQGQHKS-ILXMEBLCSA-N |
| XLogP | 4.80 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|