C23H42O5Si — CID 134839992
(2R,3R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxymethyl)-2,3-dimethyl-6-(2-oxopropyl)-6-prop-2-enylcyclohexan-1-one (PubChem CID 134839992) has the molecular formula C23H42O5Si and a molecular weight of 426.67 g/mol. Its IUPAC name is (2R,3R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxymethyl)-2,3-dimethyl-6-(2-oxopropyl)-6-prop-2-enylcyclohexan-1-one.
| Compound Name | (2R,3R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxymethyl)-2,3-dimethyl-6-(2-oxopropyl)-6-prop-2-enylcyclohexan-1-one |
|---|---|
| PubChem CID | 134839992 |
| Molecular Formula | C23H42O5Si |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | (2R,3R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxymethyl)-2,3-dimethyl-6-(2-oxopropyl)-6-prop-2-enylcyclohexan-1-one |
| SMILES | C=CC[C@]1(CC(C)=O)CC(O[Si](C)(C)C(C)(C)C)[C@H](C)[C@](C)(COCOC)C1=O |
| InChI | InChI=1S/C23H42O5Si/c1-11-12-23(13-17(2)24)14-19(28-29(9,10)21(4,5)6)18(3)22(7,20(23)25)15-27-16-26-8/h11,18-19H,1,12-16H2,2-10H3/t18-,19?,22-,23-/m0/s1 |
| InChIKey | JEGQBZGSWJYXGC-NDCZGEOTSA-N |
| XLogP | 5.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|