C24H36O5 — CID 134840125
(1S,6S,10R,12R,13R,14S,16R,19R)-3-hydroxy-3,10,12,14,16-pentamethyl-4-methylidene-18,20-dioxatetracyclo[11.5.2.01,6.016,19]icosane-15,17-dione (PubChem CID 134840125) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is (1S,6S,10R,12R,13R,14S,16R,19R)-3-hydroxy-3,10,12,14,16-pentamethyl-4-methylidene-18,20-dioxatetracyclo[11.5.2.01,6.016,19]icosane-15,17-dione.
| Compound Name | (1S,6S,10R,12R,13R,14S,16R,19R)-3-hydroxy-3,10,12,14,16-pentamethyl-4-methylidene-18,20-dioxatetracyclo[11.5.2.01,6.016,19]icosane-15,17-dione |
|---|---|
| PubChem CID | 134840125 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | (1S,6S,10R,12R,13R,14S,16R,19R)-3-hydroxy-3,10,12,14,16-pentamethyl-4-methylidene-18,20-dioxatetracyclo[11.5.2.01,6.016,19]icosane-15,17-dione |
| SMILES | C=C1C[C@@H]2CCC[C@@H](C)C[C@@H](C)[C@H]3O[C@@H]4[C@@](C)(C(=O)O[C@@]24CC1(C)O)C(=O)[C@H]3C |
| InChI | InChI=1S/C24H36O5/c1-13-8-7-9-17-11-15(3)22(5,27)12-24(17)20-23(6,21(26)29-24)19(25)16(4)18(28-20)14(2)10-13/h13-14,16-18,20,27H,3,7-12H2,1-2,4-6H3/t13-,14-,16+,17+,18-,20-,22?,23+,24+/m1/s1 |
| InChIKey | UCDQIQBSEKLHJU-WWYGJMRFSA-N |
| XLogP | 3.82 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|