C29H41NO4Si — CID 134840127
tert-butyl (4S)-4-[(1R)-1-[tert-butyl(diphenyl)silyl]oxyprop-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 134840127) has the molecular formula C29H41NO4Si and a molecular weight of 495.74 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(1R)-1-[tert-butyl(diphenyl)silyl]oxyprop-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(1R)-1-[tert-butyl(diphenyl)silyl]oxyprop-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134840127 |
| Molecular Formula | C29H41NO4Si |
| Molecular Weight | 495.74 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | tert-butyl (4S)-4-[(1R)-1-[tert-butyl(diphenyl)silyl]oxyprop-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=C[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H41NO4Si/c1-10-25(24-21-32-29(8,9)30(24)26(31)33-27(2,3)4)34-35(28(5,6)7,22-17-13-11-14-18-22)23-19-15-12-16-20-23/h10-20,24-25H,1,21H2,2-9H3/t24-,25+/m0/s1 |
| InChIKey | GKVSADKZXNNJIJ-LOSJGSFVSA-N |
| XLogP | 5.49 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.74 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|