C23H40O3Si — CID 134840297
ethyl (1S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-[(2S,3E,5E)-2-methylhepta-3,5-dienyl]cyclopent-2-ene-1-carboxylate (PubChem CID 134840297) has the molecular formula C23H40O3Si and a molecular weight of 392.66 g/mol. Its IUPAC name is ethyl (1S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-[(2S,3E,5E)-2-methylhepta-3,5-dienyl]cyclopent-2-ene-1-carboxylate.
| Compound Name | ethyl (1S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-[(2S,3E,5E)-2-methylhepta-3,5-dienyl]cyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 134840297 |
| Molecular Formula | C23H40O3Si |
| Molecular Weight | 392.66 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | ethyl (1S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-[(2S,3E,5E)-2-methylhepta-3,5-dienyl]cyclopent-2-ene-1-carboxylate |
| SMILES | C/C=C/C=C/[C@@H](C)CC1=C[C@H](O[Si](C)(C)C(C)(C)C)C[C@]1(C)C(=O)OCC |
| InChI | InChI=1S/C23H40O3Si/c1-10-12-13-14-18(3)15-19-16-20(26-27(8,9)22(4,5)6)17-23(19,7)21(24)25-11-2/h10,12-14,16,18,20H,11,15,17H2,1-9H3/b12-10+,14-13+/t18-,20+,23+/m1/s1 |
| InChIKey | IWJNEXKDJLHWRW-COKZEGLFSA-N |
| XLogP | 6.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.66 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|