C15H14O4 — CID 134840418
(3aS,9aR,9bR)-6,9-dimethyl-3-methylidene-3a,4,9a,9b-tetrahydroazuleno[4,5-b]furan-2,5,7-trione (PubChem CID 134840418) has the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. Its IUPAC name is (3aS,9aR,9bR)-6,9-dimethyl-3-methylidene-3a,4,9a,9b-tetrahydroazuleno[4,5-b]furan-2,5,7-trione.
| Compound Name | (3aS,9aR,9bR)-6,9-dimethyl-3-methylidene-3a,4,9a,9b-tetrahydroazuleno[4,5-b]furan-2,5,7-trione |
|---|---|
| PubChem CID | 134840418 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (3aS,9aR,9bR)-6,9-dimethyl-3-methylidene-3a,4,9a,9b-tetrahydroazuleno[4,5-b]furan-2,5,7-trione |
| SMILES | C=C1C(=O)O[C@H]2[C@@H]3C(C)=CC(=O)C3=C(C)C(=O)C[C@@H]12 |
| InChI | InChI=1S/C15H14O4/c1-6-4-11(17)13-8(3)10(16)5-9-7(2)15(18)19-14(9)12(6)13/h4,9,12,14H,2,5H2,1,3H3/t9-,12+,14+/m0/s1 |
| InChIKey | IVUKXKOGSTXZPY-MRCXROJRSA-N |
| XLogP | 1.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|