C24H38O6 — CID 134840644
(1S,3S,4S,6S,10R,12R,13R,14S,16R,19R)-4-hydroxy-4-(hydroxymethyl)-3,10,12,14,16-pentamethyl-18,20-dioxatetracyclo[11.5.2.01,6.016,19]icosane-15,17-dione (PubChem CID 134840644) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is (1S,3S,4S,6S,10R,12R,13R,14S,16R,19R)-4-hydroxy-4-(hydroxymethyl)-3,10,12,14,16-pentamethyl-18,20-dioxatetracyclo[11.5.2.01,6.016,19]icosane-15,17-dione.
| Compound Name | (1S,3S,4S,6S,10R,12R,13R,14S,16R,19R)-4-hydroxy-4-(hydroxymethyl)-3,10,12,14,16-pentamethyl-18,20-dioxatetracyclo[11.5.2.01,6.016,19]icosane-15,17-dione |
|---|---|
| PubChem CID | 134840644 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | (1S,3S,4S,6S,10R,12R,13R,14S,16R,19R)-4-hydroxy-4-(hydroxymethyl)-3,10,12,14,16-pentamethyl-18,20-dioxatetracyclo[11.5.2.01,6.016,19]icosane-15,17-dione |
| SMILES | C[C@@H]1CCC[C@H]2C[C@@](O)(CO)[C@@H](C)C[C@]23OC(=O)[C@@]2(C)C(=O)[C@@H](C)[C@H](O[C@H]23)[C@H](C)C1 |
| InChI | InChI=1S/C24H38O6/c1-13-7-6-8-17-11-23(28,12-25)15(3)10-24(17)20-22(5,21(27)30-24)19(26)16(4)18(29-20)14(2)9-13/h13-18,20,25,28H,6-12H2,1-5H3/t13-,14-,15+,16+,17+,18-,20-,22+,23-,24+/m1/s1 |
| InChIKey | PGWQQILYYXYKTG-ZUNOLZSTSA-N |
| XLogP | 2.88 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|