About 1-(1,2-diphenylethenoxy)pyridin-1-ium;palladium
1-(1,2-diphenylethenoxy)pyridin-1-ium;palladium (PubChem CID 134840758) has the molecular formula C19H15NOPd
and a molecular weight of 379.76 g/mol. Its IUPAC name is 1-(1,2-diphenylethenoxy)pyridin-1-ium;palladium.
Molecular Properties
| Compound Name | 1-(1,2-diphenylethenoxy)pyridin-1-ium;palladium |
| PubChem CID | 134840758 |
| Molecular Formula | C19H15NOPd |
| Molecular Weight | 379.76 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | 1-(1,2-diphenylethenoxy)pyridin-1-ium;palladium |
| SMILES | [C-](=C(\O[n+]1ccccc1)c1ccccc1)\c1ccccc1.[Pd] |
| InChI | InChI=1S/C19H15NO.Pd/c1-4-10-17(11-5-1)16-19(18-12-6-2-7-13-18)21-20-14-8-3-9-15-20;/h1-15H; |
| InChIKey | ZHAGEILQTINVSA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.76 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,2-diphenylethenoxy)pyridin-1-ium;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-diphenylethenoxy)pyridin-1-ium;palladium?
The IUPAC name of 1-(1,2-diphenylethenoxy)pyridin-1-ium;palladium (CID 134840758) is 1-(1,2-diphenylethenoxy)pyridin-1-ium;palladium.
What is the SMILES notation for 1-(1,2-diphenylethenoxy)pyridin-1-ium;palladium?
The canonical SMILES for 1-(1,2-diphenylethenoxy)pyridin-1-ium;palladium is [C-](=C(\O[n+]1ccccc1)c1ccccc1)\c1ccccc1.[Pd].
What is the InChIKey of 1-(1,2-diphenylethenoxy)pyridin-1-ium;palladium?
The InChIKey is ZHAGEILQTINVSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO.Pd/c1-4-10-17(11-5-1)16-19(18-12-6-2-7-13-18)21-20-14-8-3-9-15-20;/h1-15H;.
What are the key properties of 1-(1,2-diphenylethenoxy)pyridin-1-ium;palladium?
1-(1,2-diphenylethenoxy)pyridin-1-ium;palladium has a molecular weight of 379.76 g/mol, XLogP of 3.29, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-diphenylethenoxy)pyridin-1-ium;palladium is sourced from PubChem (CID 134840758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).