C20H24O4 — CID 134840970
(3aR,5aS,9aS,9bS,11aR)-9b-methyl-7-propan-2-yl-3,3a,5,5a,9a,10,11,11a-octahydronaphtho[2,1-e][2]benzofuran-1,6,9-trione (PubChem CID 134840970) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (3aR,5aS,9aS,9bS,11aR)-9b-methyl-7-propan-2-yl-3,3a,5,5a,9a,10,11,11a-octahydronaphtho[2,1-e][2]benzofuran-1,6,9-trione.
| Compound Name | (3aR,5aS,9aS,9bS,11aR)-9b-methyl-7-propan-2-yl-3,3a,5,5a,9a,10,11,11a-octahydronaphtho[2,1-e][2]benzofuran-1,6,9-trione |
|---|---|
| PubChem CID | 134840970 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (3aR,5aS,9aS,9bS,11aR)-9b-methyl-7-propan-2-yl-3,3a,5,5a,9a,10,11,11a-octahydronaphtho[2,1-e][2]benzofuran-1,6,9-trione |
| SMILES | CC(C)C1=CC(=O)[C@H]2[C@H](CC=C3[C@@H]4COC(=O)[C@@H]4CC[C@]32C)C1=O |
| InChI | InChI=1S/C20H24O4/c1-10(2)13-8-16(21)17-12(18(13)22)4-5-15-14-9-24-19(23)11(14)6-7-20(15,17)3/h5,8,10-12,14,17H,4,6-7,9H2,1-3H3/t11-,12+,14-,17-,20-/m1/s1 |
| InChIKey | VLQJJDZKJLSEEK-LSAHKKCTSA-N |
| XLogP | 2.87 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|