C21H28O3 — CID 134841103
methyl (1R,4aS,6aR,10aR,10bR)-2-methyl-10-oxo-2,4a,4b,6a,7,8,9,10a,10b,11,12,12a-dodecahydro-1H-chrysene-1-carboxylate (PubChem CID 134841103) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is methyl (1R,4aS,6aR,10aR,10bR)-2-methyl-10-oxo-2,4a,4b,6a,7,8,9,10a,10b,11,12,12a-dodecahydro-1H-chrysene-1-carboxylate.
| Compound Name | methyl (1R,4aS,6aR,10aR,10bR)-2-methyl-10-oxo-2,4a,4b,6a,7,8,9,10a,10b,11,12,12a-dodecahydro-1H-chrysene-1-carboxylate |
|---|---|
| PubChem CID | 134841103 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | methyl (1R,4aS,6aR,10aR,10bR)-2-methyl-10-oxo-2,4a,4b,6a,7,8,9,10a,10b,11,12,12a-dodecahydro-1H-chrysene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C(C)C=C[C@H]2C1CC[C@@H]1C2C=C[C@H]2CCCC(=O)[C@@H]12 |
| InChI | InChI=1S/C21H28O3/c1-12-6-8-14-15-9-7-13-4-3-5-18(22)20(13)17(15)11-10-16(14)19(12)21(23)24-2/h6-9,12-17,19-20H,3-5,10-11H2,1-2H3/t12?,13-,14-,15?,16?,17-,19-,20-/m1/s1 |
| InChIKey | VHDPUHWHCKLQMW-BZYXFZLQSA-N |
| XLogP | 3.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|