C18H34O6Si — CID 134841104
tert-butyl-dimethyl-[[(6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]silane (PubChem CID 134841104) has the molecular formula C18H34O6Si and a molecular weight of 374.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]silane |
|---|---|
| PubChem CID | 134841104 |
| Molecular Formula | C18H34O6Si |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | tert-butyl-dimethyl-[[(6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]silane |
| SMILES | CC1(C)OC2C3OC(C)(C)O[C@H]3C(CO[Si](C)(C)C(C)(C)C)O[C@@H]2O1 |
| InChI | InChI=1S/C18H34O6Si/c1-16(2,3)25(8,9)19-10-11-12-13(22-17(4,5)21-12)14-15(20-11)24-18(6,7)23-14/h11-15H,10H2,1-9H3/t11?,12-,13?,14?,15+/m0/s1 |
| InChIKey | ALCYFRDYTKLZHE-TZZMIGRFSA-N |
| XLogP | 3.40 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|