C16H18O3 — CID 134841178
7,10,13-trimethyl-11,15-dioxapentacyclo[5.5.2.12,5.01,6.010,13]pentadeca-3,8-dien-14-one (PubChem CID 134841178) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 7,10,13-trimethyl-11,15-dioxapentacyclo[5.5.2.12,5.01,6.010,13]pentadeca-3,8-dien-14-one.
| Compound Name | 7,10,13-trimethyl-11,15-dioxapentacyclo[5.5.2.12,5.01,6.010,13]pentadeca-3,8-dien-14-one |
|---|---|
| PubChem CID | 134841178 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 7,10,13-trimethyl-11,15-dioxapentacyclo[5.5.2.12,5.01,6.010,13]pentadeca-3,8-dien-14-one |
| SMILES | CC12C=CC3(C)OCC4(C5C=CC(O5)C14)C3(C)C2=O |
| InChI | InChI=1S/C16H18O3/c1-13-6-7-14(2)15(3,12(13)17)16(8-18-14)10-5-4-9(19-10)11(13)16/h4-7,9-11H,8H2,1-3H3 |
| InChIKey | OQTPKFZSAPNOFP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|