C27H42O3Si — CID 134841228
(4E,8E)-10-[(3S,3aS,4R,5S,6aR)-3,5-dimethyl-6-oxo-4-(3-trimethylsilylprop-2-ynyl)-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan-5-yl]-4,8-dimethyldeca-4,8-dienal (PubChem CID 134841228) has the molecular formula C27H42O3Si and a molecular weight of 442.72 g/mol. Its IUPAC name is (4E,8E)-10-[(3S,3aS,4R,5S,6aR)-3,5-dimethyl-6-oxo-4-(3-trimethylsilylprop-2-ynyl)-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan-5-yl]-4,8-dimethyldeca-4,8-dienal.
| Compound Name | (4E,8E)-10-[(3S,3aS,4R,5S,6aR)-3,5-dimethyl-6-oxo-4-(3-trimethylsilylprop-2-ynyl)-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan-5-yl]-4,8-dimethyldeca-4,8-dienal |
|---|---|
| PubChem CID | 134841228 |
| Molecular Formula | C27H42O3Si |
| Molecular Weight | 442.72 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | (4E,8E)-10-[(3S,3aS,4R,5S,6aR)-3,5-dimethyl-6-oxo-4-(3-trimethylsilylprop-2-ynyl)-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan-5-yl]-4,8-dimethyldeca-4,8-dienal |
| SMILES | C/C(=C\CC/C(C)=C/C[C@]1(C)C(=O)[C@@H]2OC[C@@H](C)[C@@H]2[C@H]1CC#C[Si](C)(C)C)CCC=O |
| InChI | InChI=1S/C27H42O3Si/c1-20(13-9-17-28)11-8-12-21(2)15-16-27(4)23(14-10-18-31(5,6)7)24-22(3)19-30-25(24)26(27)29/h11,15,17,22-25H,8-9,12-14,16,19H2,1-7H3/b20-11+,21-15+/t22-,23-,24-,25-,27+/m1/s1 |
| InChIKey | PQQZAIJDNLEETO-BCMFAVTBSA-N |
| XLogP | 6.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.72 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|