C31H56O6Si — CID 134841388
(1R,3S,5R,7R,18S)-7-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-18-methyl-13-[(E)-4-methylpent-1-enyl]-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one (PubChem CID 134841388) has the molecular formula C31H56O6Si and a molecular weight of 552.87 g/mol. Its IUPAC name is (1R,3S,5R,7R,18S)-7-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-18-methyl-13-[(E)-4-methylpent-1-enyl]-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one.
| Compound Name | (1R,3S,5R,7R,18S)-7-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-18-methyl-13-[(E)-4-methylpent-1-enyl]-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one |
|---|---|
| PubChem CID | 134841388 |
| Molecular Formula | C31H56O6Si |
| Molecular Weight | 552.87 g/mol |
| Exact Mass | 552.38 |
| IUPAC Name | (1R,3S,5R,7R,18S)-7-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-18-methyl-13-[(E)-4-methylpent-1-enyl]-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one |
| SMILES | CO[C@H]1C[C@@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)CC(CC(=O)OC(/C=C/CC(C)C)CC3CC[C@H](C)[C@@H](C1)O3)O2 |
| InChI | InChI=1S/C31H56O6Si/c1-21(2)11-10-12-23-15-24-14-13-22(3)29(35-24)19-25(33-7)16-26-17-28(37-38(8,9)31(4,5)6)18-27(34-26)20-30(32)36-23/h10,12,21-29H,11,13-20H2,1-9H3/b12-10+/t22-,23?,24?,25-,26+,27?,28+,29+/m0/s1 |
| InChIKey | QMTOLMBZMGKTRV-OIBXXSHHSA-N |
| XLogP | 7.21 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.87 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|