About dimethyl 2-[(3,4,5-triacetyloxy-6-prop-2-ynoxyoxan-2-yl)methyl]propanedioate
dimethyl 2-[(3,4,5-triacetyloxy-6-prop-2-ynoxyoxan-2-yl)methyl]propanedioate (PubChem CID 134841409) has the molecular formula C20H26O12
and a molecular weight of 458.42 g/mol. Its IUPAC name is dimethyl 2-[(3,4,5-triacetyloxy-6-prop-2-ynoxyoxan-2-yl)methyl]propanedioate.
Molecular Properties
| Compound Name | dimethyl 2-[(3,4,5-triacetyloxy-6-prop-2-ynoxyoxan-2-yl)methyl]propanedioate |
| PubChem CID | 134841409 |
| Molecular Formula | C20H26O12 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | dimethyl 2-[(3,4,5-triacetyloxy-6-prop-2-ynoxyoxan-2-yl)methyl]propanedioate |
| SMILES | C#CCOC1OC(CC(C(=O)OC)C(=O)OC)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C20H26O12/c1-7-8-28-20-17(31-12(4)23)16(30-11(3)22)15(29-10(2)21)14(32-20)9-13(18(24)26-5)19(25)27-6/h1,13-17,20H,8-9H2,2-6H3 |
| InChIKey | JFFNBLLUINWPNT-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-[(3,4,5-triacetyloxy-6-prop-2-ynoxyoxan-2-yl)methyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[(3,4,5-triacetyloxy-6-prop-2-ynoxyoxan-2-yl)methyl]propanedioate?
The IUPAC name of dimethyl 2-[(3,4,5-triacetyloxy-6-prop-2-ynoxyoxan-2-yl)methyl]propanedioate (CID 134841409) is dimethyl 2-[(3,4,5-triacetyloxy-6-prop-2-ynoxyoxan-2-yl)methyl]propanedioate.
What is the SMILES notation for dimethyl 2-[(3,4,5-triacetyloxy-6-prop-2-ynoxyoxan-2-yl)methyl]propanedioate?
The canonical SMILES for dimethyl 2-[(3,4,5-triacetyloxy-6-prop-2-ynoxyoxan-2-yl)methyl]propanedioate is C#CCOC1OC(CC(C(=O)OC)C(=O)OC)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O.
What is the InChIKey of dimethyl 2-[(3,4,5-triacetyloxy-6-prop-2-ynoxyoxan-2-yl)methyl]propanedioate?
The InChIKey is JFFNBLLUINWPNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O12/c1-7-8-28-20-17(31-12(4)23)16(30-11(3)22)15(29-10(2)21)14(32-20)9-13(18(24)26-5)19(25)27-6/h1,13-17,20H,8-9H2,2-6H3.
What are the key properties of dimethyl 2-[(3,4,5-triacetyloxy-6-prop-2-ynoxyoxan-2-yl)methyl]propanedioate?
dimethyl 2-[(3,4,5-triacetyloxy-6-prop-2-ynoxyoxan-2-yl)methyl]propanedioate has a molecular weight of 458.42 g/mol, XLogP of -0.49, 9 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[(3,4,5-triacetyloxy-6-prop-2-ynoxyoxan-2-yl)methyl]propanedioate is sourced from PubChem (CID 134841409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).