C21H28O12 — CID 134841411
dimethyl 2-[(3,4,5-triacetyloxy-6-but-3-ynoxyoxan-2-yl)methyl]propanedioate (PubChem CID 134841411) has the molecular formula C21H28O12 and a molecular weight of 472.44 g/mol. Its IUPAC name is dimethyl 2-[(3,4,5-triacetyloxy-6-but-3-ynoxyoxan-2-yl)methyl]propanedioate.
| Compound Name | dimethyl 2-[(3,4,5-triacetyloxy-6-but-3-ynoxyoxan-2-yl)methyl]propanedioate |
|---|---|
| PubChem CID | 134841411 |
| Molecular Formula | C21H28O12 |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | dimethyl 2-[(3,4,5-triacetyloxy-6-but-3-ynoxyoxan-2-yl)methyl]propanedioate |
| SMILES | C#CCCOC1OC(CC(C(=O)OC)C(=O)OC)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C21H28O12/c1-7-8-9-29-21-18(32-13(4)24)17(31-12(3)23)16(30-11(2)22)15(33-21)10-14(19(25)27-5)20(26)28-6/h1,14-18,21H,8-10H2,2-6H3 |
| InChIKey | GCOHLMXSVIIDBH-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|