C18H24O10 — CID 134841413
(3,4,5-triacetyloxy-6-buta-2,3-dienoxyoxan-2-yl)methyl acetate (PubChem CID 134841413) has the molecular formula C18H24O10 and a molecular weight of 400.38 g/mol. Its IUPAC name is (3,4,5-triacetyloxy-6-buta-2,3-dienoxyoxan-2-yl)methyl acetate.
| Compound Name | (3,4,5-triacetyloxy-6-buta-2,3-dienoxyoxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 134841413 |
| Molecular Formula | C18H24O10 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | (3,4,5-triacetyloxy-6-buta-2,3-dienoxyoxan-2-yl)methyl acetate |
| SMILES | C=C=CCOC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C18H24O10/c1-6-7-8-23-18-17(27-13(5)22)16(26-12(4)21)15(25-11(3)20)14(28-18)9-24-10(2)19/h7,14-18H,1,8-9H2,2-5H3 |
| InChIKey | LWLGHQZYFJBBSW-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|