C22H20Cl6N4O2 — CID 134841535
2,2,5,5-tetrachloro-N,N'-bis(3-chloroprop-2-enyl)-N,N'-dipyridin-2-ylhexanediamide (PubChem CID 134841535) has the molecular formula C22H20Cl6N4O2 and a molecular weight of 585.15 g/mol. Its IUPAC name is 2,2,5,5-tetrachloro-N,N'-bis(3-chloroprop-2-enyl)-N,N'-dipyridin-2-ylhexanediamide.
| Compound Name | 2,2,5,5-tetrachloro-N,N'-bis(3-chloroprop-2-enyl)-N,N'-dipyridin-2-ylhexanediamide |
|---|---|
| PubChem CID | 134841535 |
| Molecular Formula | C22H20Cl6N4O2 |
| Molecular Weight | 585.15 g/mol |
| Exact Mass | 581.97 |
| IUPAC Name | 2,2,5,5-tetrachloro-N,N'-bis(3-chloroprop-2-enyl)-N,N'-dipyridin-2-ylhexanediamide |
| SMILES | O=C(N(CC=CCl)c1ccccn1)C(Cl)(Cl)CCC(Cl)(Cl)C(=O)N(CC=CCl)c1ccccn1 |
| InChI | InChI=1S/C22H20Cl6N4O2/c23-11-5-15-31(17-7-1-3-13-29-17)19(33)21(25,26)9-10-22(27,28)20(34)32(16-6-12-24)18-8-2-4-14-30-18/h1-8,11-14H,9-10,15-16H2 |
| InChIKey | UUUIJHLLDQBFNM-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.15 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|