C32H45NO8Si — CID 134841539
(4S)-4-benzyl-3-[(E,2S,3R,6S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydroxy-2-[(4-methoxyphenyl)methoxy]oct-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 134841539) has the molecular formula C32H45NO8Si and a molecular weight of 599.80 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(E,2S,3R,6S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydroxy-2-[(4-methoxyphenyl)methoxy]oct-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(E,2S,3R,6S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydroxy-2-[(4-methoxyphenyl)methoxy]oct-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134841539 |
| Molecular Formula | C32H45NO8Si |
| Molecular Weight | 599.80 g/mol |
| Exact Mass | 599.29 |
| IUPAC Name | (4S)-4-benzyl-3-[(E,2S,3R,6S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydroxy-2-[(4-methoxyphenyl)methoxy]oct-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(CO[C@H](C(=O)N2C(=O)OC[C@@H]2Cc2ccccc2)[C@@H](/C=C/[C@H](O)[C@H](C)O)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H45NO8Si/c1-22(34)27(35)17-18-28(41-42(6,7)32(2,3)4)29(39-20-24-13-15-26(38-5)16-14-24)30(36)33-25(21-40-31(33)37)19-23-11-9-8-10-12-23/h8-18,22,25,27-29,34-35H,19-21H2,1-7H3/b18-17+/t22-,25-,27-,28+,29-/m0/s1 |
| InChIKey | WYADEEJQOSVZLR-OTVWBIFKSA-N |
| XLogP | 4.86 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.80 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|