C25H50O4Si2 — CID 134841576
ethyl (2Z,4R,5R,6E)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,7-trimethylocta-2,6-dienoate (PubChem CID 134841576) has the molecular formula C25H50O4Si2 and a molecular weight of 470.84 g/mol. Its IUPAC name is ethyl (2Z,4R,5R,6E)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,7-trimethylocta-2,6-dienoate.
| Compound Name | ethyl (2Z,4R,5R,6E)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,7-trimethylocta-2,6-dienoate |
|---|---|
| PubChem CID | 134841576 |
| Molecular Formula | C25H50O4Si2 |
| Molecular Weight | 470.84 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | ethyl (2Z,4R,5R,6E)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,7-trimethylocta-2,6-dienoate |
| SMILES | CCOC(=O)/C(C)=C\[C@@H](C)[C@H](/C=C(\C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H50O4Si2/c1-15-27-23(26)21(4)17-20(3)22(29-31(13,14)25(8,9)10)16-19(2)18-28-30(11,12)24(5,6)7/h16-17,20,22H,15,18H2,1-14H3/b19-16+,21-17-/t20-,22+/m1/s1 |
| InChIKey | RXOZOEQTFSEZMB-PWVYHTGDSA-N |
| XLogP | 7.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.84 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|