C36H51NO3Si — CID 134841598
(E,2R,3S,4S)-4-(benzhydrylamino)-3-[tert-butyl(dimethyl)silyl]oxy-1-pentan-3-yloxy-6-phenylhex-5-en-2-ol (PubChem CID 134841598) has the molecular formula C36H51NO3Si and a molecular weight of 573.89 g/mol. Its IUPAC name is (E,2R,3S,4S)-4-(benzhydrylamino)-3-[tert-butyl(dimethyl)silyl]oxy-1-pentan-3-yloxy-6-phenylhex-5-en-2-ol.
| Compound Name | (E,2R,3S,4S)-4-(benzhydrylamino)-3-[tert-butyl(dimethyl)silyl]oxy-1-pentan-3-yloxy-6-phenylhex-5-en-2-ol |
|---|---|
| PubChem CID | 134841598 |
| Molecular Formula | C36H51NO3Si |
| Molecular Weight | 573.89 g/mol |
| Exact Mass | 573.36 |
| IUPAC Name | (E,2R,3S,4S)-4-(benzhydrylamino)-3-[tert-butyl(dimethyl)silyl]oxy-1-pentan-3-yloxy-6-phenylhex-5-en-2-ol |
| SMILES | CCC(CC)OC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C/c1ccccc1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H51NO3Si/c1-8-31(9-2)39-27-33(38)35(40-41(6,7)36(3,4)5)32(26-25-28-19-13-10-14-20-28)37-34(29-21-15-11-16-22-29)30-23-17-12-18-24-30/h10-26,31-35,37-38H,8-9,27H2,1-7H3/b26-25+/t32-,33+,35-/m0/s1 |
| InChIKey | HVACJFRFKWROTQ-UAIHHHSDSA-N |
| XLogP | 8.40 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.89 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|