About 4-methyl-N-[(2R,3R)-3-methyl-1-oxo-1-phenylpent-4-en-2-yl]benzenesulfonamide
4-methyl-N-[(2R,3R)-3-methyl-1-oxo-1-phenylpent-4-en-2-yl]benzenesulfonamide (PubChem CID 134841621) has the molecular formula C19H21NO3S
and a molecular weight of 343.45 g/mol. Its IUPAC name is 4-methyl-N-[(2R,3R)-3-methyl-1-oxo-1-phenylpent-4-en-2-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-methyl-N-[(2R,3R)-3-methyl-1-oxo-1-phenylpent-4-en-2-yl]benzenesulfonamide |
| PubChem CID | 134841621 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 4-methyl-N-[(2R,3R)-3-methyl-1-oxo-1-phenylpent-4-en-2-yl]benzenesulfonamide |
| SMILES | C=C[C@@H](C)[C@@H](NS(=O)(=O)c1ccc(C)cc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H21NO3S/c1-4-15(3)18(19(21)16-8-6-5-7-9-16)20-24(22,23)17-12-10-14(2)11-13-17/h4-13,15,18,20H,1H2,2-3H3/t15-,18-/m1/s1 |
| InChIKey | LSJOEHMOIAJHDZ-CRAIPNDOSA-N |
| XLogP | 3.35 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-N-[(2R,3R)-3-methyl-1-oxo-1-phenylpent-4-en-2-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-[(2R,3R)-3-methyl-1-oxo-1-phenylpent-4-en-2-yl]benzenesulfonamide?
The IUPAC name of 4-methyl-N-[(2R,3R)-3-methyl-1-oxo-1-phenylpent-4-en-2-yl]benzenesulfonamide (CID 134841621) is 4-methyl-N-[(2R,3R)-3-methyl-1-oxo-1-phenylpent-4-en-2-yl]benzenesulfonamide.
What is the SMILES notation for 4-methyl-N-[(2R,3R)-3-methyl-1-oxo-1-phenylpent-4-en-2-yl]benzenesulfonamide?
The canonical SMILES for 4-methyl-N-[(2R,3R)-3-methyl-1-oxo-1-phenylpent-4-en-2-yl]benzenesulfonamide is C=C[C@@H](C)[C@@H](NS(=O)(=O)c1ccc(C)cc1)C(=O)c1ccccc1.
What is the InChIKey of 4-methyl-N-[(2R,3R)-3-methyl-1-oxo-1-phenylpent-4-en-2-yl]benzenesulfonamide?
The InChIKey is LSJOEHMOIAJHDZ-CRAIPNDOSA-N. The full InChI is InChI=1S/C19H21NO3S/c1-4-15(3)18(19(21)16-8-6-5-7-9-16)20-24(22,23)17-12-10-14(2)11-13-17/h4-13,15,18,20H,1H2,2-3H3/t15-,18-/m1/s1.
What are the key properties of 4-methyl-N-[(2R,3R)-3-methyl-1-oxo-1-phenylpent-4-en-2-yl]benzenesulfonamide?
4-methyl-N-[(2R,3R)-3-methyl-1-oxo-1-phenylpent-4-en-2-yl]benzenesulfonamide has a molecular weight of 343.45 g/mol, XLogP of 3.35, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-[(2R,3R)-3-methyl-1-oxo-1-phenylpent-4-en-2-yl]benzenesulfonamide is sourced from PubChem (CID 134841621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).