C32H51BrO8Si2 — CID 134841633
(1S,5S,6R,8S,10S,11S,13R)-8-bromo-11,15,18,18-tetramethyl-10,13-bis(triethylsilyloxy)-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-ene-3,7,12,16-tetrone (PubChem CID 134841633) has the molecular formula C32H51BrO8Si2 and a molecular weight of 699.83 g/mol. Its IUPAC name is (1S,5S,6R,8S,10S,11S,13R)-8-bromo-11,15,18,18-tetramethyl-10,13-bis(triethylsilyloxy)-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-ene-3,7,12,16-tetrone.
| Compound Name | (1S,5S,6R,8S,10S,11S,13R)-8-bromo-11,15,18,18-tetramethyl-10,13-bis(triethylsilyloxy)-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-ene-3,7,12,16-tetrone |
|---|---|
| PubChem CID | 134841633 |
| Molecular Formula | C32H51BrO8Si2 |
| Molecular Weight | 699.83 g/mol |
| Exact Mass | 698.23 |
| IUPAC Name | (1S,5S,6R,8S,10S,11S,13R)-8-bromo-11,15,18,18-tetramethyl-10,13-bis(triethylsilyloxy)-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-ene-3,7,12,16-tetrone |
| SMILES | CC[Si](CC)(CC)O[C@H]1C(=O)[C@]2(C)[C@@H](O[Si](CC)(CC)CC)C[C@H](Br)C(=O)[C@H]2[C@@H]2OC(=O)O[C@]23CC(=O)C(C)=C1C3(C)C |
| InChI | InChI=1S/C32H51BrO8Si2/c1-11-42(12-2,13-3)40-22-17-20(33)25(35)24-28-32(39-29(37)38-28)18-21(34)19(7)23(30(32,8)9)26(27(36)31(22,24)10)41-43(14-4,15-5)16-6/h20,22,24,26,28H,11-18H2,1-10H3/t20-,22-,24-,26+,28-,31+,32+/m0/s1 |
| InChIKey | GJOXTDBNUPFOLG-LVEJPUKDSA-N |
| XLogP | 7.30 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.83 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|