C30H58O7Si2 — CID 134841638
ethyl (2E,4E,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(2S,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxybutyl]oxiran-2-yl]-2,4,6-trimethylhepta-2,4-dienoate (PubChem CID 134841638) has the molecular formula C30H58O7Si2 and a molecular weight of 586.96 g/mol. Its IUPAC name is ethyl (2E,4E,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(2S,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxybutyl]oxiran-2-yl]-2,4,6-trimethylhepta-2,4-dienoate.
| Compound Name | ethyl (2E,4E,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(2S,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxybutyl]oxiran-2-yl]-2,4,6-trimethylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 134841638 |
| Molecular Formula | C30H58O7Si2 |
| Molecular Weight | 586.96 g/mol |
| Exact Mass | 586.37 |
| IUPAC Name | ethyl (2E,4E,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(2S,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxybutyl]oxiran-2-yl]-2,4,6-trimethylhepta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C)=C/C(C)=C/[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1[C@@H](CC(O)CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H58O7Si2/c1-15-34-28(33)22(4)17-20(2)16-21(3)25(37-39(13,14)30(8,9)10)27-26(35-27)24(18-23(32)19-31)36-38(11,12)29(5,6)7/h16-17,21,23-27,31-32H,15,18-19H2,1-14H3/b20-16+,22-17+/t21-,23?,24-,25+,26+,27-/m1/s1 |
| InChIKey | XCNRPZVDAIRVQP-QFKSQKKWSA-N |
| XLogP | 6.37 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.96 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|