C20H36O5Si — CID 134841662
(3E,5R,6R,7Z)-5-[tert-butyl(dimethyl)silyl]oxy-9-ethoxy-3,6,8-trimethyl-9-oxonona-3,7-dienoic acid (PubChem CID 134841662) has the molecular formula C20H36O5Si and a molecular weight of 384.59 g/mol. Its IUPAC name is (3E,5R,6R,7Z)-5-[tert-butyl(dimethyl)silyl]oxy-9-ethoxy-3,6,8-trimethyl-9-oxonona-3,7-dienoic acid.
| Compound Name | (3E,5R,6R,7Z)-5-[tert-butyl(dimethyl)silyl]oxy-9-ethoxy-3,6,8-trimethyl-9-oxonona-3,7-dienoic acid |
|---|---|
| PubChem CID | 134841662 |
| Molecular Formula | C20H36O5Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (3E,5R,6R,7Z)-5-[tert-butyl(dimethyl)silyl]oxy-9-ethoxy-3,6,8-trimethyl-9-oxonona-3,7-dienoic acid |
| SMILES | CCOC(=O)/C(C)=C\[C@@H](C)[C@H](/C=C(\C)CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H36O5Si/c1-10-24-19(23)16(4)13-15(3)17(11-14(2)12-18(21)22)25-26(8,9)20(5,6)7/h11,13,15,17H,10,12H2,1-9H3,(H,21,22)/b14-11+,16-13-/t15-,17+/m1/s1 |
| InChIKey | MURPYSWYNLTFHY-RFVSJUPCSA-N |
| XLogP | 4.94 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|