C10H15BrO2 — CID 134841700
(7aS)-7a-(2-bromoethyl)-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one (PubChem CID 134841700) has the molecular formula C10H15BrO2 and a molecular weight of 247.13 g/mol. Its IUPAC name is (7aS)-7a-(2-bromoethyl)-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one.
| Compound Name | (7aS)-7a-(2-bromoethyl)-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 134841700 |
| Molecular Formula | C10H15BrO2 |
| Molecular Weight | 247.13 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | (7aS)-7a-(2-bromoethyl)-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one |
| SMILES | O=C1OCC2CCCC[C@@]12CCBr |
| InChI | InChI=1S/C10H15BrO2/c11-6-5-10-4-2-1-3-8(10)7-13-9(10)12/h8H,1-7H2/t8?,10-/m0/s1 |
| InChIKey | BOTQPDPDNCIURX-HTLJXXAVSA-N |
| XLogP | 2.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.13 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|