C21H28O3S — CID 134842046
(1R,5R)-5-[4-(benzenesulfonyl)-6-methylhepta-1,5-dien-2-yl]-2-methylcyclohex-2-en-1-ol (PubChem CID 134842046) has the molecular formula C21H28O3S and a molecular weight of 360.52 g/mol. Its IUPAC name is (1R,5R)-5-[4-(benzenesulfonyl)-6-methylhepta-1,5-dien-2-yl]-2-methylcyclohex-2-en-1-ol.
| Compound Name | (1R,5R)-5-[4-(benzenesulfonyl)-6-methylhepta-1,5-dien-2-yl]-2-methylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 134842046 |
| Molecular Formula | C21H28O3S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (1R,5R)-5-[4-(benzenesulfonyl)-6-methylhepta-1,5-dien-2-yl]-2-methylcyclohex-2-en-1-ol |
| SMILES | C=C(CC(C=C(C)C)S(=O)(=O)c1ccccc1)[C@@H]1CC=C(C)[C@H](O)C1 |
| InChI | InChI=1S/C21H28O3S/c1-15(2)12-20(25(23,24)19-8-6-5-7-9-19)13-17(4)18-11-10-16(3)21(22)14-18/h5-10,12,18,20-22H,4,11,13-14H2,1-3H3/t18-,20?,21-/m1/s1 |
| InChIKey | GPDAPQAMOSWQCE-TXZDUHFLSA-N |
| XLogP | 4.46 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|