C22H17F3OS — CID 134842157
4,4,4-trifluoro-1,3-diphenyl-3-phenylsulfanylbutan-1-one (PubChem CID 134842157) has the molecular formula C22H17F3OS and a molecular weight of 386.44 g/mol. Its IUPAC name is 4,4,4-trifluoro-1,3-diphenyl-3-phenylsulfanylbutan-1-one.
| Compound Name | 4,4,4-trifluoro-1,3-diphenyl-3-phenylsulfanylbutan-1-one |
|---|---|
| PubChem CID | 134842157 |
| Molecular Formula | C22H17F3OS |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 4,4,4-trifluoro-1,3-diphenyl-3-phenylsulfanylbutan-1-one |
| SMILES | O=C(CC(Sc1ccccc1)(c1ccccc1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C22H17F3OS/c23-22(24,25)21(18-12-6-2-7-13-18,27-19-14-8-3-9-15-19)16-20(26)17-10-4-1-5-11-17/h1-15H,16H2 |
| InChIKey | IRNULSWLGMZBQJ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |