C24H52O3Si2 — CID 134842206
(3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]dodec-1-en-5-ol (PubChem CID 134842206) has the molecular formula C24H52O3Si2 and a molecular weight of 444.85 g/mol. Its IUPAC name is (3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]dodec-1-en-5-ol.
| Compound Name | (3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]dodec-1-en-5-ol |
|---|---|
| PubChem CID | 134842206 |
| Molecular Formula | C24H52O3Si2 |
| Molecular Weight | 444.85 g/mol |
| Exact Mass | 444.35 |
| IUPAC Name | (3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]dodec-1-en-5-ol |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CCCCCCC |
| InChI | InChI=1S/C24H52O3Si2/c1-13-15-16-17-18-19-20(25)22(27-29(11,12)24(6,7)8)21(14-2)26-28(9,10)23(3,4)5/h14,20-22,25H,2,13,15-19H2,1,3-12H3/t20-,21+,22-/m1/s1 |
| InChIKey | FCQPGUJDYBKSEX-BHIFYINESA-N |
| XLogP | 7.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.85 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|