C23H20O3 — CID 134842283
methyl 7-methylidene-2-oxo-4,6-diphenylbicyclo[3.2.1]oct-3-ene-1-carboxylate (PubChem CID 134842283) has the molecular formula C23H20O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is methyl 7-methylidene-2-oxo-4,6-diphenylbicyclo[3.2.1]oct-3-ene-1-carboxylate.
| Compound Name | methyl 7-methylidene-2-oxo-4,6-diphenylbicyclo[3.2.1]oct-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 134842283 |
| Molecular Formula | C23H20O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | methyl 7-methylidene-2-oxo-4,6-diphenylbicyclo[3.2.1]oct-3-ene-1-carboxylate |
| SMILES | C=C1C(c2ccccc2)C2CC1(C(=O)OC)C(=O)C=C2c1ccccc1 |
| InChI | InChI=1S/C23H20O3/c1-15-21(17-11-7-4-8-12-17)19-14-23(15,22(25)26-2)20(24)13-18(19)16-9-5-3-6-10-16/h3-13,19,21H,1,14H2,2H3 |
| InChIKey | NVYUAUGGCPXLTQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|