C18H20NO3S — CID 134842308
CID 134842308 (PubChem CID 134842308) has the molecular formula C18H20NO3S and a molecular weight of 330.43 g/mol.
| Compound Name | CID 134842308 |
|---|---|
| PubChem CID | 134842308 |
| Molecular Formula | C18H20NO3S |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | — |
| SMILES | C[C](CS(=O)(=O)c1ccc(C)cc1)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C18H20NO3S/c1-14-9-11-17(12-10-14)23(21,22)13-15(2)18(20)19(3)16-7-5-4-6-8-16/h4-12H,13H2,1-3H3 |
| InChIKey | QZSXHBHIUYDDNO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |