C24H53O3Si2+ — CID 134842332
[(3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]dodec-1-en-5-yl]oxidanium (PubChem CID 134842332) has the molecular formula C24H53O3Si2+ and a molecular weight of 445.86 g/mol. Its IUPAC name is [(3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]dodec-1-en-5-yl]oxidanium.
| Compound Name | [(3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]dodec-1-en-5-yl]oxidanium |
|---|---|
| PubChem CID | 134842332 |
| Molecular Formula | C24H53O3Si2+ |
| Molecular Weight | 445.86 g/mol |
| Exact Mass | 445.35 |
| IUPAC Name | [(3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]dodec-1-en-5-yl]oxidanium |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]([OH2+])CCCCCCC |
| InChI | InChI=1S/C24H52O3Si2/c1-13-15-16-17-18-19-20(25)22(27-29(11,12)24(6,7)8)21(14-2)26-28(9,10)23(3,4)5/h14,20-22,25H,2,13,15-19H2,1,3-12H3/p+1/t20-,21+,22-/m1/s1 |
| InChIKey | FCQPGUJDYBKSEX-BHIFYINESA-O |
| XLogP | 7.41 |
| TPSA | 41.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.86 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|