C15H19N3OS — CID 134842486
2-phenyl-5-(2,2,5,5-tetramethyl-1,3-thiazolidin-4-yl)-1,3,4-oxadiazole (PubChem CID 134842486) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-phenyl-5-(2,2,5,5-tetramethyl-1,3-thiazolidin-4-yl)-1,3,4-oxadiazole.
| Compound Name | 2-phenyl-5-(2,2,5,5-tetramethyl-1,3-thiazolidin-4-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 134842486 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-phenyl-5-(2,2,5,5-tetramethyl-1,3-thiazolidin-4-yl)-1,3,4-oxadiazole |
| SMILES | CC1(C)NC(c2nnc(-c3ccccc3)o2)C(C)(C)S1 |
| InChI | InChI=1S/C15H19N3OS/c1-14(2)11(16-15(3,4)20-14)13-18-17-12(19-13)10-8-6-5-7-9-10/h5-9,11,16H,1-4H3 |
| InChIKey | UDONPYHBYKNUIQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |