C13H20N2O3 — CID 134842544
methyl (5R,7Z,10S)-11-methyl-12-oxo-1,11-diazaspiro[4.7]dodec-7-ene-10-carboxylate (PubChem CID 134842544) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is methyl (5R,7Z,10S)-11-methyl-12-oxo-1,11-diazaspiro[4.7]dodec-7-ene-10-carboxylate.
| Compound Name | methyl (5R,7Z,10S)-11-methyl-12-oxo-1,11-diazaspiro[4.7]dodec-7-ene-10-carboxylate |
|---|---|
| PubChem CID | 134842544 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | methyl (5R,7Z,10S)-11-methyl-12-oxo-1,11-diazaspiro[4.7]dodec-7-ene-10-carboxylate |
| SMILES | COC(=O)[C@@H]1C/C=C\C[C@]2(CCCN2)C(=O)N1C |
| InChI | InChI=1S/C13H20N2O3/c1-15-10(11(16)18-2)6-3-4-7-13(12(15)17)8-5-9-14-13/h3-4,10,14H,5-9H2,1-2H3/b4-3-/t10-,13-/m0/s1 |
| InChIKey | DTYWREFBWLVOEQ-NQRSUBDPSA-N |
| XLogP | 0.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|