C25H40O5SSi — CID 134842648
methyl 5-[(6S)-2-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]-2-methylpentanoate (PubChem CID 134842648) has the molecular formula C25H40O5SSi and a molecular weight of 480.74 g/mol. Its IUPAC name is methyl 5-[(6S)-2-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]-2-methylpentanoate.
| Compound Name | methyl 5-[(6S)-2-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]-2-methylpentanoate |
|---|---|
| PubChem CID | 134842648 |
| Molecular Formula | C25H40O5SSi |
| Molecular Weight | 480.74 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | methyl 5-[(6S)-2-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]-2-methylpentanoate |
| SMILES | COC(=O)C(C)CCCC1=C(S(=O)(=O)c2ccccc2)CCC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H40O5SSi/c1-19(24(26)29-5)13-11-16-21-22(30-32(6,7)25(2,3)4)17-12-18-23(21)31(27,28)20-14-9-8-10-15-20/h8-10,14-15,19,22H,11-13,16-18H2,1-7H3/t19?,22-/m0/s1 |
| InChIKey | XCHIJHIACWWHEF-BPARTEKVSA-N |
| XLogP | 6.27 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.74 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|