C23H37NO3S2Si — CID 134842668
(3R,5R)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyheptan-1-one (PubChem CID 134842668) has the molecular formula C23H37NO3S2Si and a molecular weight of 467.77 g/mol. Its IUPAC name is (3R,5R)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyheptan-1-one.
| Compound Name | (3R,5R)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyheptan-1-one |
|---|---|
| PubChem CID | 134842668 |
| Molecular Formula | C23H37NO3S2Si |
| Molecular Weight | 467.77 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | (3R,5R)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyheptan-1-one |
| SMILES | CC[C@H](C[C@@H](O)CC(=O)N1C(=S)SC[C@H]1Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H37NO3S2Si/c1-7-20(27-30(5,6)23(2,3)4)14-19(25)15-21(26)24-18(16-29-22(24)28)13-17-11-9-8-10-12-17/h8-12,18-20,25H,7,13-16H2,1-6H3/t18-,19-,20-/m1/s1 |
| InChIKey | ZLNSOMKUOOGECP-VAMGGRTRSA-N |
| XLogP | 5.40 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.77 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|