C28H26O7S — CID 134842683
[(3R,6S)-4,5-dibenzoyloxy-6-ethylsulfanyloxan-3-yl] benzoate (PubChem CID 134842683) has the molecular formula C28H26O7S and a molecular weight of 506.58 g/mol. Its IUPAC name is [(3R,6S)-4,5-dibenzoyloxy-6-ethylsulfanyloxan-3-yl] benzoate.
| Compound Name | [(3R,6S)-4,5-dibenzoyloxy-6-ethylsulfanyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 134842683 |
| Molecular Formula | C28H26O7S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | [(3R,6S)-4,5-dibenzoyloxy-6-ethylsulfanyloxan-3-yl] benzoate |
| SMILES | CCS[C@@H]1OC[C@@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H26O7S/c1-2-36-28-24(35-27(31)21-16-10-5-11-17-21)23(34-26(30)20-14-8-4-9-15-20)22(18-32-28)33-25(29)19-12-6-3-7-13-19/h3-17,22-24,28H,2,18H2,1H3/t22-,23?,24?,28+/m1/s1 |
| InChIKey | JGUKQTIDXLDKQH-FEYTXPRCSA-N |
| XLogP | 4.77 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|