C24H26O8S — CID 134842749
dimethyl 1,1-dioxo-3-phenyl-5-(2-phenyl-1,3-dioxolan-2-yl)thiane-4,4-dicarboxylate (PubChem CID 134842749) has the molecular formula C24H26O8S and a molecular weight of 474.53 g/mol. Its IUPAC name is dimethyl 1,1-dioxo-3-phenyl-5-(2-phenyl-1,3-dioxolan-2-yl)thiane-4,4-dicarboxylate.
| Compound Name | dimethyl 1,1-dioxo-3-phenyl-5-(2-phenyl-1,3-dioxolan-2-yl)thiane-4,4-dicarboxylate |
|---|---|
| PubChem CID | 134842749 |
| Molecular Formula | C24H26O8S |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | dimethyl 1,1-dioxo-3-phenyl-5-(2-phenyl-1,3-dioxolan-2-yl)thiane-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C(c2ccccc2)CS(=O)(=O)CC1C1(c2ccccc2)OCCO1 |
| InChI | InChI=1S/C24H26O8S/c1-29-21(25)23(22(26)30-2)19(17-9-5-3-6-10-17)15-33(27,28)16-20(23)24(31-13-14-32-24)18-11-7-4-8-12-18/h3-12,19-20H,13-16H2,1-2H3 |
| InChIKey | LKPAXHPULAJCFA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|